| 1 | Ammonium thiosulphate |
| 2 | Diammonium thiosulfate |
| 3 | Thio-Sul |
| 4 | Ammonium hyposulfite |
| 5 | Ammo hypo |
Ammonium thiosulfate is an inorganic ammonium salt composed of ammonium and thiosulfate ions in a 2:1 ratio. It is used in the leaching of gold and silver, as a fertilizer and as a photographic fixing salt. It has a role as a fertilizer, a herbicide safener, a bleaching agent and a reducing agent. It contains a thiosulfate(2-).
| Molecular Formula | H8N2O3S2 |
|---|---|
| Canonical SMILES | [NH4+].[NH4+].[O-]S(=O)(=S)[O-] |
| Isomeric SMILES | [NH4+].[NH4+].[O-]S(=O)(=S)[O-] |
| Molecular Weight | 148.2100 |
| InChIKey | XYXNTHIYBIDHGM-UHFFFAOYSA-N |
| InChI | InChI=1S/2H3N.H2O3S2/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4) |
| XLogP | 0.0000 |
| ExactMass | 147.9976 |
| MonoisotopicMass | 147.9976 |
| TPSA | 106.0000 |
| Complexity | 82.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 7 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 3 |
| PatentCount | 27964 |
| PatentFamilyCount | 18126 |
| LiteratureCount | 138 |