1 | ACENAPHTHENE |
2 | 1,2-Dihydroacenaphthylene |
3 | 1,8-Ethylenenaphthalene |
4 | peri-Ethylenenaphthalene |
5 | Naphthyleneethylene |
Acenaphthene is a polycyclic aromatic hydrocarbon derived from naphthalene by the addition of an ethylene bridge connecting C-1 and C-8.
Molecular Formula | C12H10 |
---|---|
Canonical SMILES | C1CC2=CC=CC3=C2C1=CC=C3 |
Isomeric SMILES | C1CC2=CC=CC3=C2C1=CC=C3 |
Molecular Weight | 154.2100 |
InChIKey | CWRYPZZKDGJXCA-UHFFFAOYSA-N |
InChI | InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2 |
XLogP | 3.9000 |
ExactMass | 154.0783 |
MonoisotopicMass | 154.0783 |
TPSA | 0.0000 |
Complexity | 155.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 0 |
HeavyAtomCount | 12 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 19821 |
PatentFamilyCount | 8656 |
LiteratureCount | 4427 |