1 | ACENAPHTHYLENE |
2 | Acenaphthalene |
3 | Cyclopenta[de]naphthalene |
4 | Cyclopenta(de)naphthalene |
5 | DTXSID3023845 |
Acenaphthylene is a ortho- and peri-fused tricyclic hydrocarbon that occurs in coal tar. It is an ortho- and peri-fused polycyclic arene, a member of acenaphthylenes and an ortho- and peri-fused tricyclic hydrocarbon.
Molecular Formula | C12H8 |
---|---|
Canonical SMILES | C1=CC2=C3C(=C1)C=CC3=CC=C2 |
Isomeric SMILES | C1=CC2=C3C(=C1)C=CC3=CC=C2 |
Molecular Weight | 152.1900 |
InChIKey | HXGDTGSAIMULJN-UHFFFAOYSA-N |
InChI | InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H |
XLogP | 3.7000 |
ExactMass | 152.0626 |
MonoisotopicMass | 152.0626 |
TPSA | 0.0000 |
Complexity | 184.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 0 |
HeavyAtomCount | 12 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 13637 |
PatentFamilyCount | 5337 |
LiteratureCount | 3401 |