| 1 | ACENAPHTHYLENE |
| 2 | Acenaphthalene |
| 3 | Cyclopenta[de]naphthalene |
| 4 | Cyclopenta(de)naphthalene |
| 5 | DTXSID3023845 |
Acenaphthylene is a ortho- and peri-fused tricyclic hydrocarbon that occurs in coal tar. It is an ortho- and peri-fused polycyclic arene, a member of acenaphthylenes and an ortho- and peri-fused tricyclic hydrocarbon.
| Molecular Formula | C12H8 |
|---|---|
| Canonical SMILES | C1=CC2=C3C(=C1)C=CC3=CC=C2 |
| Isomeric SMILES | C1=CC2=C3C(=C1)C=CC3=CC=C2 |
| Molecular Weight | 152.1900 |
| InChIKey | HXGDTGSAIMULJN-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H |
| XLogP | 3.7000 |
| ExactMass | 152.0626 |
| MonoisotopicMass | 152.0626 |
| TPSA | 0.0000 |
| Complexity | 184.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 12 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 13637 |
| PatentFamilyCount | 5337 |
| LiteratureCount | 3401 |