1 | Ametryn |
2 | AMETRYNE |
3 | Gesapax |
4 | Ametrex |
5 | Evik |
Ametryn is a methylthio-1,3,5-triazine that is 2-(methylsulfanyl)-1,3,5-triazine substituted by an ethylamino and an isopropylamino group at positions 4 and 6 respectively. It has a role as a herbicide and an environmental contaminant. It is a diamino-1,3,5-triazine and a methylthio-1,3,5-triazine.
Molecular Formula | C9H17N5S |
---|---|
Canonical SMILES | CCNC1=NC(=NC(=N1)SC)NC(C)C |
Isomeric SMILES | CCNC1=NC(=NC(=N1)SC)NC(C)C |
Molecular Weight | 227.3300 |
InChIKey | RQVYBGPQFYCBGX-UHFFFAOYSA-N |
InChI | InChI=1S/C9H17N5S/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
XLogP | 3.0000 |
ExactMass | 227.1205 |
MonoisotopicMass | 227.1205 |
TPSA | 88.0000 |
Complexity | 178.0000 |
Charge | 0.0000 |
HBondDonorCount | 2 |
HBondAcceptorCount | 6 |
RotatableBondCount | 5 |
HeavyAtomCount | 15 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 22898 |
PatentFamilyCount | 5662 |
LiteratureCount | 934 |