1 | AMPHETAMINE |
2 | Amfetamine |
3 | 1-phenylpropan-2-amine |
4 | dl-Amphetamine |
5 | Desoxynorephedrine |
1-phenylpropan-2-amine is a primary amine that is isopropylamine in which a hydrogen attached to one of the methyl groups has been replaced by a phenyl group.
Molecular Formula | C9H13N |
---|---|
Canonical SMILES | CC(CC1=CC=CC=C1)N |
Isomeric SMILES | CC(CC1=CC=CC=C1)N |
Molecular Weight | 135.2100 |
InChIKey | KWTSXDURSIMDCE-UHFFFAOYSA-N |
InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
XLogP | 1.8000 |
ExactMass | 135.1048 |
MonoisotopicMass | 135.1048 |
TPSA | 26.0000 |
Complexity | 84.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 1 |
RotatableBondCount | 2 |
HeavyAtomCount | 10 |
IsotopeAtomCount | 0 |
AtomStereoCount | 1 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 1 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 54493 |
PatentFamilyCount | 16677 |
LiteratureCount | 37733 |