1 | O-ANISIDINE |
2 | 2-Methoxyaniline |
3 | 2-Anisidine |
4 | 2-Aminoanisole |
5 | o-Aminoanisole |
o-Anisidine can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C7H9NO |
---|---|
Canonical SMILES | COC1=CC=CC=C1N |
Isomeric SMILES | COC1=CC=CC=C1N |
Molecular Weight | 123.1500 |
InChIKey | VMPITZXILSNTON-UHFFFAOYSA-N |
InChI | InChI=1S/C7H9NO/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3 |
XLogP | 1.2000 |
ExactMass | 123.0684 |
MonoisotopicMass | 123.0684 |
TPSA | 35.2000 |
Complexity | 85.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 2 |
RotatableBondCount | 1 |
HeavyAtomCount | 9 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 19169 |
PatentFamilyCount | 8205 |
LiteratureCount | 1070 |