1 | p-Anisidine |
2 | 4-Methoxyaniline |
3 | 4-Methoxybenzenamine |
4 | 4-Anisidine |
5 | 4-Aminoanisole |
P-anisidine is a substituted aniline that is aniline in which the hydrogen para to the amino group has been replaced by a methoxy group. It is used as a reagent for the detection of oxidation products such as aldehydes and ketones in fats and oils. It has a role as a reagent and a genotoxin. It is a member of methoxybenzenes, a substituted aniline and a primary amino compound.
Molecular Formula | C7H9NO |
---|---|
Canonical SMILES | COC1=CC=C(C=C1)N |
Isomeric SMILES | COC1=CC=C(C=C1)N |
Molecular Weight | 123.1500 |
InChIKey | BHAAPTBBJKJZER-UHFFFAOYSA-N |
InChI | InChI=1S/C7H9NO/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
XLogP | 0.9000 |
ExactMass | 123.0684 |
MonoisotopicMass | 123.0684 |
TPSA | 35.2000 |
Complexity | 77.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 2 |
RotatableBondCount | 1 |
HeavyAtomCount | 9 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 36346 |
PatentFamilyCount | 13756 |
LiteratureCount | 3348 |