1 | ANTHRACENE |
2 | Paranaphthalene |
3 | Anthracin |
4 | Tetra Olive N2G |
5 | Anthracen |
Anthracene can cause cancer according to California Labor Code and the World Health Organization's International Agency for Research on Cancer (IARC).
Molecular Formula | C14H10 |
---|---|
Canonical SMILES | C1=CC=C2C=C3C=CC=CC3=CC2=C1 |
Isomeric SMILES | C1=CC=C2C=C3C=CC=CC3=CC2=C1 |
Molecular Weight | 178.2300 |
InChIKey | MWPLVEDNUUSJAV-UHFFFAOYSA-N |
InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
XLogP | 4.4000 |
ExactMass | 178.0783 |
MonoisotopicMass | 178.0783 |
TPSA | 0.0000 |
Complexity | 154.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 0 |
HeavyAtomCount | 14 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 32643 |
PatentFamilyCount | 17477 |
LiteratureCount | 21898 |