1 | lindane |
2 | beta-HCH |
3 | alpha-HCH |
4 | 1,2,3,4,5,6-Hexachlorocyclohexane |
5 | gamma-HCH |
Hexachlorocyclohexane (all isomers including lindane) can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C6H6Cl6 |
---|---|
Canonical SMILES | C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl |
Isomeric SMILES | C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl |
Molecular Weight | 290.8000 |
InChIKey | JLYXXMFPNIAWKQ-UHFFFAOYSA-N |
InChI | InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
XLogP | 3.8000 |
ExactMass | 289.8571 |
MonoisotopicMass | 287.8601 |
TPSA | 0.0000 |
Complexity | 104.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 0 |
HeavyAtomCount | 12 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 104118 |
PatentFamilyCount | 40780 |
LiteratureCount | 10591 |