1 | 1,3-Dichloroacetone |
2 | 1,3-Dichloro-2-propanone |
3 | 1,3-dichloropropan-2-one |
4 | 1,3-Dichloropropanone |
5 | sym-Dichloroacetone |
1,3-dichloroacetone is a ketone that is propan-2-one in which a hydrogen at positions 1 and 3 have been replaced by chloro groups. It is used in the synthesis of citric acid. Also used as a solvent and as an intermediate in organic synthesis. It is an organochlorine compound and a ketone. It is functionally related to a 1,3-dichloropropan-2-ol.
Molecular Formula | C3H4Cl2O |
---|---|
Canonical SMILES | C(C(=O)CCl)Cl |
Isomeric SMILES | C(C(=O)CCl)Cl |
Molecular Weight | 126.9700 |
InChIKey | SUNMBRGCANLOEG-UHFFFAOYSA-N |
InChI | InChI=1S/C3H4Cl2O/c4-1-3(6)2-5/h1-2H2 |
XLogP | 1.2000 |
ExactMass | 125.9639 |
MonoisotopicMass | 125.9639 |
TPSA | 17.1000 |
Complexity | 46.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 1 |
RotatableBondCount | 2 |
HeavyAtomCount | 6 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 8236 |
PatentFamilyCount | 2752 |
LiteratureCount | 1778 |