1 | BROMOACETONE |
2 | 1-Bromo-2-propanone |
3 | 1-bromopropan-2-one |
4 | Monobromoacetone |
5 | bromopropanone |
Bromoacetone is an alpha-bromoketone that is acetone in which one of the hydrogens is replaced by a bromine atom. A poweful lachrymator, it was formerly used as a chemical weapon. It has a role as a lachrymator. It is functionally related to an acetone.
Molecular Formula | C3H5BrO |
---|---|
Canonical SMILES | CC(=O)CBr |
Isomeric SMILES | CC(=O)CBr |
Molecular Weight | 136.9800 |
InChIKey | VQFAIAKCILWQPZ-UHFFFAOYSA-N |
InChI | InChI=1S/C3H5BrO/c1-3(5)2-4/h2H2,1H3 |
XLogP | 0.7000 |
ExactMass | 135.9524 |
MonoisotopicMass | 135.9524 |
TPSA | 17.1000 |
Complexity | 42.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 1 |
RotatableBondCount | 1 |
HeavyAtomCount | 5 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 4169 |
PatentFamilyCount | 1636 |
LiteratureCount | 539 |