1 | 1-Bromo-4-phenoxybenzene |
2 | 4-Bromodiphenyl ether |
3 | 4-Bromophenyl phenyl ether |
4 | 4-Bromophenoxybenzene |
5 | Benzene, 1-bromo-4-phenoxy- |
4-bromophenyl phenyl ether is an aromatic ether that is diphenyl ether substituted at position 4 by a bromo group. It is an aromatic ether and an organobromine compound. It is functionally related to a diphenyl ether.
Molecular Formula | C12H9BrO |
---|---|
Canonical SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
Isomeric SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
Molecular Weight | 249.1000 |
InChIKey | JDUYPUMQALQRCN-UHFFFAOYSA-N |
InChI | InChI=1S/C12H9BrO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H |
XLogP | 4.4000 |
ExactMass | 247.9837 |
MonoisotopicMass | 247.9837 |
TPSA | 9.2000 |
Complexity | 158.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 1 |
RotatableBondCount | 2 |
HeavyAtomCount | 14 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 1555 |
PatentFamilyCount | 580 |
LiteratureCount | 129 |