1 | BUTYL ACRYLATE |
2 | n-Butyl acrylate |
3 | butyl prop-2-enoate |
4 | 2-Propenoic acid, butyl ester |
5 | n-Butyl propenoate |
Butyl acrylate is an acrylate ester obtained by the formal condensation of the hydroxy group of butan-1-ol with the carboxy group of acrylic acid. It is functionally related to a butan-1-ol and an acrylic acid.
Molecular Formula | C7H12O2 |
---|---|
Canonical SMILES | CCCCOC(=O)C=C |
Isomeric SMILES | CCCCOC(=O)C=C |
Molecular Weight | 128.1700 |
InChIKey | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
InChI | InChI=1S/C7H12O2/c1-3-5-6-9-7(8)4-2/h4H,2-3,5-6H2,1H3 |
XLogP | 2.4000 |
ExactMass | 128.0837 |
MonoisotopicMass | 128.0837 |
TPSA | 26.3000 |
Complexity | 97.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 2 |
RotatableBondCount | 5 |
HeavyAtomCount | 9 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 161905 |
PatentFamilyCount | 68033 |
LiteratureCount | 3451 |