1 | ISOBUTYLAMINE |
2 | 2-methylpropan-1-amine |
3 | 1-Amino-2-methylpropane |
4 | 2-Methylpropylamine |
5 | Monoisobutylamine |
2-methylpropanamine is an alkylamine having isobutyl as the alkyl group. It has been isolated from Sambucus nigra (Elderberry). It has a role as a plant metabolite. It is a conjugate base of a 2-methylpropanaminium.
Molecular Formula | C4H11N |
---|---|
Canonical SMILES | CC(C)CN |
Isomeric SMILES | CC(C)CN |
Molecular Weight | 73.1400 |
InChIKey | KDSNLYIMUZNERS-UHFFFAOYSA-N |
InChI | InChI=1S/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3 |
XLogP | 0.7000 |
ExactMass | 73.0891 |
MonoisotopicMass | 73.0891 |
TPSA | 26.0000 |
Complexity | 17.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 1 |
RotatableBondCount | 1 |
HeavyAtomCount | 5 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 47993 |
PatentFamilyCount | 17166 |
LiteratureCount | 894 |