1 | chlorambucil |
2 | Ambochlorin |
3 | Leukeran |
4 | Chloroambucil |
5 | Chloraminophen |
Chlorambucil can cause cancer according to California Labor Code. It can cause developmental toxicity according to an independent committee of scientific and health experts.
Molecular Formula | C14H19Cl2NO2 |
---|---|
Canonical SMILES | C1=CC(=CC=C1CCCC(=O)O)N(CCCl)CCCl |
Isomeric SMILES | C1=CC(=CC=C1CCCC(=O)O)N(CCCl)CCCl |
Molecular Weight | 304.2000 |
InChIKey | JCKYGMPEJWAADB-UHFFFAOYSA-N |
InChI | InChI=1S/C14H19Cl2NO2/c15-8-10-17(11-9-16)13-6-4-12(5-7-13)2-1-3-14(18)19/h4-7H,1-3,8-11H2,(H,18,19) |
XLogP | 1.7000 |
ExactMass | 303.0793 |
MonoisotopicMass | 303.0793 |
TPSA | 40.5000 |
Complexity | 250.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 3 |
RotatableBondCount | 9 |
HeavyAtomCount | 19 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 126750 |
PatentFamilyCount | 33327 |
LiteratureCount | 10713 |