1 | 3-Chloro-2-methylpropene |
2 | 3-Chloro-2-methylprop-1-ene |
3 | Methallyl chloride |
4 | 3-CHLORO-2-METHYL-1-PROPENE |
5 | 2-Methylallyl chloride |
3-Chloro-2-methylpropene can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C4H7Cl |
---|---|
Canonical SMILES | CC(=C)CCl |
Isomeric SMILES | CC(=C)CCl |
Molecular Weight | 90.5500 |
InChIKey | OHXAOPZTJOUYKM-UHFFFAOYSA-N |
InChI | InChI=1S/C4H7Cl/c1-4(2)3-5/h1,3H2,2H3 |
XLogP | 2.1000 |
ExactMass | 90.0236 |
MonoisotopicMass | 90.0236 |
TPSA | 0.0000 |
Complexity | 38.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 1 |
HeavyAtomCount | 5 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 9777 |
PatentFamilyCount | 4138 |
LiteratureCount | 400 |