1 | CHLOROPRENE |
2 | 2-Chloro-1,3-butadiene |
3 | 2-Chlorobuta-1,3-diene |
4 | Chlorobutadiene |
5 | 2-Chlorobutadiene |
Chloroprene can cause cancer according to The World Health Organization's International Agency for Research on Cancer (IARC) and The National Toxicology Program.
Molecular Formula | C4H5Cl |
---|---|
Canonical SMILES | C=CC(=C)Cl |
Isomeric SMILES | C=CC(=C)Cl |
Molecular Weight | 88.5300 |
InChIKey | YACLQRRMGMJLJV-UHFFFAOYSA-N |
InChI | InChI=1S/C4H5Cl/c1-3-4(2)5/h3H,1-2H2 |
XLogP | 2.3000 |
ExactMass | 88.0080 |
MonoisotopicMass | 88.0080 |
TPSA | 0.0000 |
Complexity | 54.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 1 |
HeavyAtomCount | 5 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 35844 |
PatentFamilyCount | 22113 |
LiteratureCount | 1297 |