1 | CHLOROTHALONIL |
2 | Tetrachloroisophthalonitrile |
3 | Daconil |
4 | Bravo |
5 | m-Tcpn |
Chlorothalonil can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C8Cl4N2 |
---|---|
Canonical SMILES | C(#N)C1=C(C(=C(C(=C1Cl)Cl)Cl)C#N)Cl |
Isomeric SMILES | C(#N)C1=C(C(=C(C(=C1Cl)Cl)Cl)C#N)Cl |
Molecular Weight | 265.9000 |
InChIKey | CRQQGFGUEAVUIL-UHFFFAOYSA-N |
InChI | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
XLogP | 2.9000 |
ExactMass | 265.8786 |
MonoisotopicMass | 263.8816 |
TPSA | 47.6000 |
Complexity | 284.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 2 |
RotatableBondCount | 0 |
HeavyAtomCount | 14 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 130110 |
PatentFamilyCount | 42528 |
LiteratureCount | 2505 |