1 | 4-Chloro-2-methylaniline |
2 | 4-CHLORO-O-TOLUIDINE |
3 | 2-Amino-5-chlorotoluene |
4 | p-Chloro-o-toluidine |
5 | Fast Red TR Base |
p-Chloro-o-toluidine can cause cancer according to The World Health Organization's International Agency for Research on Cancer (IARC) and The Environmental Protection Agency (EPA).
Molecular Formula | C7H8ClN |
---|---|
Canonical SMILES | CC1=C(C=CC(=C1)Cl)N |
Isomeric SMILES | CC1=C(C=CC(=C1)Cl)N |
Molecular Weight | 141.6000 |
InChIKey | CXNVOWPRHWWCQR-UHFFFAOYSA-N |
InChI | InChI=1S/C7H8ClN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
XLogP | 1.9000 |
ExactMass | 141.0345 |
MonoisotopicMass | 141.0345 |
TPSA | 26.0000 |
Complexity | 94.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 1 |
RotatableBondCount | 0 |
HeavyAtomCount | 9 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 4196 |
PatentFamilyCount | 1966 |
LiteratureCount | 247 |