1 | chlorpyrifos |
2 | Dursban |
3 | Chlorpyriphos |
4 | Lorsban |
5 | Trichlorpyrphos |
Chlorpyrifos can cause developmental toxicity according to an independent committee of scientific and health experts.
Molecular Formula | C9H11Cl3NO3PS |
---|---|
Canonical SMILES | CCOP(=S)(OCC)OC1=NC(=C(C=C1Cl)Cl)Cl |
Isomeric SMILES | CCOP(=S)(OCC)OC1=NC(=C(C=C1Cl)Cl)Cl |
Molecular Weight | 350.6000 |
InChIKey | SBPBAQFWLVIOKP-UHFFFAOYSA-N |
InChI | InChI=1S/C9H11Cl3NO3PS/c1-3-14-17(18,15-4-2)16-9-7(11)5-6(10)8(12)13-9/h5H,3-4H2,1-2H3 |
XLogP | 5.3000 |
ExactMass | 348.9263 |
MonoisotopicMass | 348.9263 |
TPSA | 72.7000 |
Complexity | 303.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 5 |
RotatableBondCount | 6 |
HeavyAtomCount | 18 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 52468 |
PatentFamilyCount | 14972 |
LiteratureCount | 11170 |