1 | Chlorpyrifos-methyl |
2 | Trichlormethylfos |
3 | Chloropyriphos-methyl |
4 | Methyl chlorpyrifos |
5 | Reldan |
Chlorpyrifos-methyl is an organic thiophosphate that is O,O-dimethyl hydrogen phosphorothioate in which the hydrogen of the hydroxy group has been replaced by a 3,5,6-trichloropyridin-2-yl group. It has a role as an agrochemical, an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an environmental contaminant, a xenobiotic, an acaricide and an insecticide. It is an organic thiophosphate and a chloropyridine.
Molecular Formula | C7H7Cl3NO3PS |
---|---|
Canonical SMILES | COP(=S)(OC)OC1=NC(=C(C=C1Cl)Cl)Cl |
Isomeric SMILES | COP(=S)(OC)OC1=NC(=C(C=C1Cl)Cl)Cl |
Molecular Weight | 322.5000 |
InChIKey | HRBKVYFZANMGRE-UHFFFAOYSA-N |
InChI | InChI=1S/C7H7Cl3NO3PS/c1-12-15(16,13-2)14-7-5(9)3-4(8)6(10)11-7/h3H,1-2H3 |
XLogP | 4.3000 |
ExactMass | 320.8950 |
MonoisotopicMass | 320.8950 |
TPSA | 72.7000 |
Complexity | 278.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 5 |
RotatableBondCount | 4 |
HeavyAtomCount | 16 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 25961 |
PatentFamilyCount | 6320 |
LiteratureCount | 780 |