1 | MALACHITE GREEN |
2 | Basic Green 4 |
3 | Malachite green chloride |
4 | China Green |
5 | Victoria Green B |
Malachite green is an organic chloride salt that is the monochloride salt of malachite green cation. Used as a green-coloured dye, as a counter-stain in histology, and for its anti-fungal properties in aquaculture. It has a role as a fluorochrome, a histological dye, an antifungal drug, a carcinogenic agent, a teratogenic agent, an environmental contaminant and an antibacterial agent. It contains a malachite green cation.
Molecular Formula | C23H25ClN2 |
---|---|
Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3.[Cl-] |
Isomeric SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3.[Cl-] |
Molecular Weight | 364.9000 |
InChIKey | FDZZZRQASAIRJF-UHFFFAOYSA-M |
InChI | InChI=1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
XLogP | 0.0000 |
ExactMass | 364.1706 |
MonoisotopicMass | 364.1706 |
TPSA | 6.2000 |
Complexity | 516.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 2 |
RotatableBondCount | 3 |
HeavyAtomCount | 26 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 2 |
PatentCount | 55332 |
PatentFamilyCount | 24544 |
LiteratureCount | 6536 |