1 | Direct Black 38 |
2 | Chlorazol Black E |
3 | C.I. Direct Black 38 |
4 | Chlorazol black |
5 | Azo Black |
Direct Black 38 (Technical Grade) can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C34H25N9Na2O7S2 |
---|---|
Canonical SMILES | C1=CC=C(C=C1)N=NC2=C(C3=C(C(=C(C=C3C=C2S(=O)(=O)[O-])S(=O)(=O)[O-])N=NC4=CC=C(C=C4)C5=CC=C(C=C5)N=NC6=C(C=C(C=C6)N)N)N)O.[Na+].[Na+] |
Isomeric SMILES | C1=CC=C(C=C1)N=NC2=C(C3=C(C(=C(C=C3C=C2S(=O)(=O)[O-])S(=O)(=O)[O-])N=NC4=CC=C(C=C4)C5=CC=C(C=C5)N=NC6=C(C=C(C=C6)N)N)N)O.[Na+].[Na+] |
Molecular Weight | 781.7000 |
InChIKey | XRPLBRIHZGVJIC-UHFFFAOYSA-L |
InChI | InChI=1S/C34H27N9O7S2.2Na/c35-22-10-15-27(26(36)18-22)41-38-24-11-6-19(7-12-24)20-8-13-25(14-9-20)40-42-32-28(51(45,46)47)16-21-17-29(52(48,49)50)33(34(44)30(21)31(32)37)43-39-23-4-2-1-3-5-23;;/h1-18,44H,35-37H2,(H,45,46,47)(H,48,49,50);;/q;2*+1/p-2 |
XLogP | 0.0000 |
ExactMass | 781.1114 |
MonoisotopicMass | 781.1114 |
TPSA | 304.0000 |
Complexity | 1460.0000 |
Charge | 0.0000 |
HBondDonorCount | 4 |
HBondAcceptorCount | 16 |
RotatableBondCount | 7 |
HeavyAtomCount | 54 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 3 |
PatentCount | 1 |
PatentFamilyCount | 1 |
LiteratureCount | 112 |