1 | o-Aminoazotoluene |
2 | Solvent Yellow 3 |
3 | Fast Garnet GBC Base |
4 | 2-Aminoazotoluene |
5 | C.I. Solvent Yellow 3 |
o-Aminoazotoluene can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C14H15N3 |
---|---|
Canonical SMILES | CC1=CC=CC=C1N=NC2=CC(=C(C=C2)N)C |
Isomeric SMILES | CC1=CC=CC=C1N=NC2=CC(=C(C=C2)N)C |
Molecular Weight | 225.2900 |
InChIKey | PFRYFZZSECNQOL-UHFFFAOYSA-N |
InChI | InChI=1S/C14H15N3/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12/h3-9H,15H2,1-2H3 |
XLogP | 3.7000 |
ExactMass | 225.1266 |
MonoisotopicMass | 225.1266 |
TPSA | 50.7000 |
Complexity | 264.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 3 |
RotatableBondCount | 2 |
HeavyAtomCount | 17 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 1341 |
PatentFamilyCount | 892 |
LiteratureCount | 315 |