1 | AURAMINE |
2 | Yellow pyoctanine |
3 | Glauramine |
4 | Auramine base |
5 | Auramine O base |
Auramine can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C17H21N3 |
---|---|
Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C |
Isomeric SMILES | CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C |
Molecular Weight | 267.3700 |
InChIKey | JPIYZTWMUGTEHX-UHFFFAOYSA-N |
InChI | InChI=1S/C17H21N3/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4/h5-12,18H,1-4H3 |
XLogP | 4.0000 |
ExactMass | 267.1735 |
MonoisotopicMass | 267.1735 |
TPSA | 30.3000 |
Complexity | 278.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 3 |
RotatableBondCount | 4 |
HeavyAtomCount | 20 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 22133 |
PatentFamilyCount | 11227 |
LiteratureCount | 1596 |