1 | COUMAPHOS |
2 | Coumafos |
3 | Asuntol |
4 | Asunthol |
5 | Meldane |
Coumaphos is an organothiophosphate insecticide, an organic thiophosphate and an organochlorine compound. It has a role as an agrochemical, an acaricide, an antinematodal drug, an avicide and an EC 3.1.1.8 (cholinesterase) inhibitor. It is functionally related to a chlorferron.
Molecular Formula | C14H16ClO5PS |
---|---|
Canonical SMILES | CCOP(=S)(OCC)OC1=CC2=C(C=C1)C(=C(C(=O)O2)Cl)C |
Isomeric SMILES | CCOP(=S)(OCC)OC1=CC2=C(C=C1)C(=C(C(=O)O2)Cl)C |
Molecular Weight | 362.8000 |
InChIKey | BXNANOICGRISHX-UHFFFAOYSA-N |
InChI | InChI=1S/C14H16ClO5PS/c1-4-17-21(22,18-5-2)20-10-6-7-11-9(3)13(15)14(16)19-12(11)8-10/h6-8H,4-5H2,1-3H3 |
XLogP | 4.5000 |
ExactMass | 362.0145 |
MonoisotopicMass | 362.0145 |
TPSA | 86.1000 |
Complexity | 500.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 6 |
RotatableBondCount | 6 |
HeavyAtomCount | 22 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 18222 |
PatentFamilyCount | 4173 |
LiteratureCount | 1056 |