| 1 | 2-Methoxy-5-methylaniline |
| 2 | P-CRESIDINE |
| 3 | Cresidine |
| 4 | para-Cresidine |
| 5 | 5-Methyl-o-anisidine |
p-Cresidine can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C8H11NO |
|---|---|
| Canonical SMILES | CC1=CC(=C(C=C1)OC)N |
| Isomeric SMILES | CC1=CC(=C(C=C1)OC)N |
| Molecular Weight | 137.1800 |
| InChIKey | WXWCDTXEKCVRRO-UHFFFAOYSA-N |
| InChI | InChI=1S/C8H11NO/c1-6-3-4-8(10-2)7(9)5-6/h3-5H,9H2,1-2H3 |
| XLogP | 1.7000 |
| ExactMass | 137.0841 |
| MonoisotopicMass | 137.0841 |
| TPSA | 35.2000 |
| Complexity | 105.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 10 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 5313 |
| PatentFamilyCount | 2743 |
| LiteratureCount | 172 |