1 | CYHALOTHRIN |
2 | Cyhalothrine |
3 | Grenade |
4 | lambda-Cyhalothrin |
5 | PP 563 |
Cyhalothrin is a carboxylic ester obtained by formal condensation between 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid and cyano(3-phenoxyphenyl)methanol. It has a role as a pyrethroid ester insecticide, a pyrethroid ester acaricide and an agrochemical. It is an aromatic ether, a nitrile, an organochlorine compound, an organofluorine compound and a cyclopropanecarboxylate ester. It is functionally related to a 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid.
Molecular Formula | C23H19ClF3NO3 |
---|---|
Canonical SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(C(F)(F)F)Cl)C |
Isomeric SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)/C=C(/C(F)(F)F)\Cl)C |
Molecular Weight | 449.8000 |
InChIKey | ZXQYGBMAQZUVMI-UNOMPAQXSA-N |
InChI | InChI=1S/C23H19ClF3NO3/c1-22(2)17(12-19(24)23(25,26)27)20(22)21(29)31-18(13-28)14-7-6-10-16(11-14)30-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/b19-12- |
XLogP | 6.1000 |
ExactMass | 449.1006 |
MonoisotopicMass | 449.1006 |
TPSA | 59.3000 |
Complexity | 736.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 7 |
RotatableBondCount | 7 |
HeavyAtomCount | 31 |
IsotopeAtomCount | 0 |
AtomStereoCount | 3 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 3 |
BondStereoCount | 1 |
DefinedBondStereoCount | 1 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 20811 |
PatentFamilyCount | 6424 |
LiteratureCount | 1582 |