1 | 2,6-Dichlorobenzonitrile |
2 | dichlobenil |
3 | Benzonitrile, 2,6-dichloro- |
4 | Dichlobanil |
5 | Casoron |
2,6-dichlorobenzonitrile is a nitrile that is benzonitrile which is substituted by chlorines at positions 2 and 6. A cellulose synthesis inhibitor, it is used as a pre-emergent and early post-emergent herbicide. It has a role as a herbicide, an agrochemical, a cellulose synthesis inhibitor, a xenobiotic and an environmental contaminant. It is a nitrile and a dichlorobenzene. It is functionally related to a benzonitrile.
Molecular Formula | C7H3Cl2N |
---|---|
Canonical SMILES | C1=CC(=C(C(=C1)Cl)C#N)Cl |
Isomeric SMILES | C1=CC(=C(C(=C1)Cl)C#N)Cl |
Molecular Weight | 172.0100 |
InChIKey | YOYAIZYFCNQIRF-UHFFFAOYSA-N |
InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
XLogP | 2.7000 |
ExactMass | 170.9643 |
MonoisotopicMass | 170.9643 |
TPSA | 23.8000 |
Complexity | 150.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 1 |
RotatableBondCount | 0 |
HeavyAtomCount | 10 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 23642 |
PatentFamilyCount | 6798 |
LiteratureCount | 900 |