1 | 1,2-DICHLOROBENZENE |
2 | o-Dichlorobenzene |
3 | ortho-Dichlorobenzene |
4 | o-Dichlorbenzol |
5 | 2-Dichlorobenzene |
1,2-dichlorobenzene is a dichlorobenzene carrying chloro substituents at positions 1 and 2. It has a role as a hepatotoxic agent and a metabolite.
Molecular Formula | C6H4Cl2 |
---|---|
Canonical SMILES | C1=CC=C(C(=C1)Cl)Cl |
Isomeric SMILES | C1=CC=C(C(=C1)Cl)Cl |
Molecular Weight | 147.0000 |
InChIKey | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
InChI | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |
XLogP | 3.4000 |
ExactMass | 145.9690 |
MonoisotopicMass | 145.9690 |
TPSA | 0.0000 |
Complexity | 62.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 0 |
HeavyAtomCount | 8 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 123140 |
PatentFamilyCount | 47701 |
LiteratureCount | 6061 |