| 1 | 1,4-DICHLOROBENZENE |
| 2 | p-Dichlorobenzene |
| 3 | paradichlorobenzene |
| 4 | para-Dichlorobenzene |
| 5 | Paracide |
p-Dichlorobenzene can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C6H4Cl2 |
|---|---|
| Canonical SMILES | C1=CC(=CC=C1Cl)Cl |
| Isomeric SMILES | C1=CC(=CC=C1Cl)Cl |
| Molecular Weight | 147.0000 |
| InChIKey | OCJBOOLMMGQPQU-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H |
| XLogP | 3.4000 |
| ExactMass | 145.9690 |
| MonoisotopicMass | 145.9690 |
| TPSA | 0.0000 |
| Complexity | 54.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 8 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 88600 |
| PatentFamilyCount | 34930 |
| LiteratureCount | 3444 |