| 1 | Dichlorophen |
| 2 | dichlorophene |
| 3 | 2,2'-Methylenebis(4-chlorophenol) |
| 4 | Didroxane |
| 5 | Anthiphen |
Dichlorophene can cause developmental toxicity according to The Environmental Protection Agency (EPA).
| Molecular Formula | C13H10Cl2O2 |
|---|---|
| Canonical SMILES | C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O |
| Isomeric SMILES | C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O |
| Molecular Weight | 269.1200 |
| InChIKey | MDNWOSOZYLHTCG-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 |
| XLogP | 4.3000 |
| ExactMass | 268.0058 |
| MonoisotopicMass | 268.0058 |
| TPSA | 40.5000 |
| Complexity | 226.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 17 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 42234 |
| PatentFamilyCount | 10718 |
| LiteratureCount | 489 |