1 | 2,4-DICHLOROPHENOL |
2 | Phenol, 2,4-dichloro- |
3 | 4,6-Dichlorophenol |
4 | 2,4-DCP |
5 | 2,4-dichloro-Phenol |
2,4-dichlorophenol is a dichlorophenol that is phenol carrying chloro substituents at positions 2 and 4.
Molecular Formula | C6H4Cl2O |
---|---|
Canonical SMILES | C1=CC(=C(C=C1Cl)Cl)O |
Isomeric SMILES | C1=CC(=C(C=C1Cl)Cl)O |
Molecular Weight | 163.0000 |
InChIKey | HFZWRUODUSTPEG-UHFFFAOYSA-N |
InChI | InChI=1S/C6H4Cl2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H |
XLogP | 3.1000 |
ExactMass | 161.9639 |
MonoisotopicMass | 161.9639 |
TPSA | 20.2000 |
Complexity | 97.0000 |
Charge | 0.0000 |
HBondDonorCount | 1 |
HBondAcceptorCount | 1 |
RotatableBondCount | 0 |
HeavyAtomCount | 9 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 13243 |
PatentFamilyCount | 5262 |
LiteratureCount | 3814 |