1 | PARAOXON |
2 | Phosphacol |
3 | Diethyl paraoxon |
4 | Diethyl 4-nitrophenyl phosphate |
5 | Diethyl p-nitrophenyl phosphate |
Paraoxon is an aryl dialkyl phosphate where both the alkyl groups are ethyl and the aryl group is 4-nitrophenyl. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor and a mouse metabolite. It is an aryl dialkyl phosphate and an organophosphate insecticide.
Molecular Formula | C10H14NO6P |
---|---|
Canonical SMILES | CCOP(=O)(OCC)OC1=CC=C(C=C1)[N+](=O)[O-] |
Isomeric SMILES | CCOP(=O)(OCC)OC1=CC=C(C=C1)[N+](=O)[O-] |
Molecular Weight | 275.1900 |
InChIKey | WYMSBXTXOHUIGT-UHFFFAOYSA-N |
InChI | InChI=1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
XLogP | 2.0000 |
ExactMass | 275.0559 |
MonoisotopicMass | 275.0559 |
TPSA | 90.6000 |
Complexity | 300.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 6 |
RotatableBondCount | 6 |
HeavyAtomCount | 18 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 9452 |
PatentFamilyCount | 3288 |
LiteratureCount | 4735 |