1 | DIETHYL PHTHALATE |
2 | Ethyl phthalate |
3 | phthalic acid diethyl ester |
4 | Anozol |
5 | diethyl benzene-1,2-dicarboxylate |
Diethyl phthalate is the diethyl ester of benzene-1,2-dicarboxylic acid. It has a role as a teratogenic agent, a neurotoxin and a plasticiser. It is a phthalate ester, a diester and an ethyl ester.
Molecular Formula | C12H14O4 |
---|---|
Canonical SMILES | CCOC(=O)C1=CC=CC=C1C(=O)OCC |
Isomeric SMILES | CCOC(=O)C1=CC=CC=C1C(=O)OCC |
Molecular Weight | 222.2400 |
InChIKey | FLKPEMZONWLCSK-UHFFFAOYSA-N |
InChI | InChI=1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
XLogP | 2.5000 |
ExactMass | 222.0892 |
MonoisotopicMass | 222.0892 |
TPSA | 52.6000 |
Complexity | 223.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 4 |
RotatableBondCount | 6 |
HeavyAtomCount | 16 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 117656 |
PatentFamilyCount | 45855 |
LiteratureCount | 2779 |