| 1 | DINOTERB |
| 2 | 2-tert-Butyl-4,6-dinitrophenol |
| 3 | Dinoterbe |
| 4 | Stirpan forte |
| 5 | Herbogil |
Dinoterb is a member of phenols and a C-nitro compound.
| Molecular Formula | C10H12N2O5 |
|---|---|
| Canonical SMILES | CC(C)(C)C1=C(C(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-])O |
| Isomeric SMILES | CC(C)(C)C1=C(C(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-])O |
| Molecular Weight | 240.2100 |
| InChIKey | IIPZYDQGBIWLBU-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H12N2O5/c1-10(2,3)7-4-6(11(14)15)5-8(9(7)13)12(16)17/h4-5,13H,1-3H3 |
| XLogP | 3.4000 |
| ExactMass | 240.0746 |
| MonoisotopicMass | 240.0746 |
| TPSA | 112.0000 |
| Complexity | 314.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 5 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 17 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 15497 |
| PatentFamilyCount | 3040 |
| LiteratureCount | 146 |