EPN
CAS: 2104-64-5
| 1 | EPN |
| 2 | Santox |
| 3 | O-Ethyl O-(4-nitrophenyl) phenylphosphonothioate |
| 4 | Kasutop Dust |
| 5 | Tsumaphos |
EPN is an organic phosphonate, a phosphonic ester and an organothiophosphate insecticide. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an acaricide and an agrochemical.
| Molecular Formula | C14H14NO4PS |
|---|---|
| Canonical SMILES | CCOP(=S)(C1=CC=CC=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
| Isomeric SMILES | CCOP(=S)(C1=CC=CC=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
| Molecular Weight | 323.3100 |
| InChIKey | AIGRXSNSLVJMEA-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H14NO4PS/c1-2-18-20(21,14-6-4-3-5-7-14)19-13-10-8-12(9-11-13)15(16)17/h3-11H,2H2,1H3 |
| XLogP | 4.4000 |
| ExactMass | 323.0381 |
| MonoisotopicMass | 323.0381 |
| TPSA | 96.4000 |
| Complexity | 387.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 5 |
| RotatableBondCount | 5 |
| HeavyAtomCount | 21 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 14672 |
| PatentFamilyCount | 3968 |
| LiteratureCount | 257 |