1 | ETHYL ACETATE |
2 | Ethyl ethanoate |
3 | Acetic acid ethyl ester |
4 | Acetoxyethane |
5 | Vinegar naphtha |
Ethyl acetate is the acetate ester formed between acetic acid and ethanol. It has a role as a polar aprotic solvent, an EC 3.4.19.3 (pyroglutamyl-peptidase I) inhibitor, a metabolite and a Saccharomyces cerevisiae metabolite. It is an acetate ester, an ethyl ester and a volatile organic compound.
Molecular Formula | C4H8O2 |
---|---|
Canonical SMILES | CCOC(=O)C |
Isomeric SMILES | CCOC(=O)C |
Molecular Weight | 88.1100 |
InChIKey | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
InChI | InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
XLogP | 0.7000 |
ExactMass | 88.0524 |
MonoisotopicMass | 88.0524 |
TPSA | 26.3000 |
Complexity | 49.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 2 |
RotatableBondCount | 2 |
HeavyAtomCount | 6 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 154944 |
PatentFamilyCount | 93179 |
LiteratureCount | 85176 |