1 | Fenpropathrin |
2 | Meothrin |
3 | Danimen |
4 | Danitol |
5 | Rody |
Fenpropathrin is a cyclopropanecarboxylate ester obtained by formal condensation between 2,2,3,3-tetramethylcyclopropanecarboxylic acid and cyano(3-phenoxyphenyl)methanol. It has a role as a pyrethroid ester insecticide, a pyrethroid ester acaricide and an agrochemical. It is an aromatic ether and a cyclopropanecarboxylate ester. It is functionally related to a 2,2,3,3-tetramethylcyclopropanecarboxylic acid.
Molecular Formula | C22H23NO3 |
---|---|
Canonical SMILES | CC1(C(C1(C)C)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C |
Isomeric SMILES | CC1(C(C1(C)C)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C |
Molecular Weight | 349.4000 |
InChIKey | XQUXKZZNEFRCAW-UHFFFAOYSA-N |
InChI | InChI=1S/C22H23NO3/c1-21(2)19(22(21,3)4)20(24)26-18(14-23)15-9-8-12-17(13-15)25-16-10-6-5-7-11-16/h5-13,18-19H,1-4H3 |
XLogP | 5.7000 |
ExactMass | 349.1678 |
MonoisotopicMass | 349.1678 |
TPSA | 59.3000 |
Complexity | 553.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 4 |
RotatableBondCount | 6 |
HeavyAtomCount | 26 |
IsotopeAtomCount | 0 |
AtomStereoCount | 1 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 1 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 32058 |
PatentFamilyCount | 8348 |
LiteratureCount | 761 |