1 | FENSULFOTHION |
2 | Dasanit |
3 | Daconit |
4 | Terracur P |
5 | Bayer 25141 |
Fensulfothion is an organic thiophosphate, a sulfoxide and an organothiophosphate insecticide. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an agrochemical, an avicide and a nematicide. It is functionally related to a 4-(methylsulfinyl)phenol.
Molecular Formula | C11H17O4PS2 |
---|---|
Canonical SMILES | CCOP(=S)(OCC)OC1=CC=C(C=C1)S(=O)C |
Isomeric SMILES | CCOP(=S)(OCC)OC1=CC=C(C=C1)S(=O)C |
Molecular Weight | 308.4000 |
InChIKey | XDNBJTQLKCIJBV-UHFFFAOYSA-N |
InChI | InChI=1S/C11H17O4PS2/c1-4-13-16(17,14-5-2)15-10-6-8-11(9-7-10)18(3)12/h6-9H,4-5H2,1-3H3 |
XLogP | 2.2000 |
ExactMass | 308.0306 |
MonoisotopicMass | 308.0306 |
TPSA | 96.1000 |
Complexity | 306.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 6 |
RotatableBondCount | 7 |
HeavyAtomCount | 18 |
IsotopeAtomCount | 0 |
AtomStereoCount | 1 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 1 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 12201 |
PatentFamilyCount | 2787 |
LiteratureCount | 385 |