1 | FLUORENE |
2 | 9H-Fluorene |
3 | Diphenylenemethane |
4 | o-Biphenylenemethane |
5 | 2,3-Benzindene |
Fluorene is an ortho-fused tricyclic hydrocarbon that is a major component of fossil fuels and their derivatives It is an ortho-fused polycyclic arene and an ortho-fused tricyclic hydrocarbon.
Molecular Formula | C13H10 |
---|---|
Canonical SMILES | C1C2=CC=CC=C2C3=CC=CC=C31 |
Isomeric SMILES | C1C2=CC=CC=C2C3=CC=CC=C31 |
Molecular Weight | 166.2200 |
InChIKey | NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
InChI | InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
XLogP | 4.2000 |
ExactMass | 166.0783 |
MonoisotopicMass | 166.0783 |
TPSA | 0.0000 |
Complexity | 165.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 0 |
RotatableBondCount | 0 |
HeavyAtomCount | 13 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 99089 |
PatentFamilyCount | 40852 |
LiteratureCount | 8025 |