1 | Methyl eugenol |
2 | METHYLEUGENOL |
3 | 4-Allyl-1,2-dimethoxybenzene |
4 | Eugenol methyl ether |
5 | 4-Allylveratrole |
Methyleugenol can cause cancer according to The National Toxicology Program.
Molecular Formula | C11H14O2 |
---|---|
Canonical SMILES | COC1=C(C=C(C=C1)CC=C)OC |
Isomeric SMILES | COC1=C(C=C(C=C1)CC=C)OC |
Molecular Weight | 178.2300 |
InChIKey | ZYEMGPIYFIJGTP-UHFFFAOYSA-N |
InChI | InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 |
XLogP | 2.5000 |
ExactMass | 178.0994 |
MonoisotopicMass | 178.0994 |
TPSA | 18.5000 |
Complexity | 156.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 2 |
RotatableBondCount | 4 |
HeavyAtomCount | 13 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 14589 |
PatentFamilyCount | 4994 |
LiteratureCount | 1810 |