1 | N-NITROSODIETHYLAMINE |
2 | Diethylnitrosamine |
3 | NDEA |
4 | N-Ethyl-N-nitrosoethanamine |
5 | Diethylnitrosoamine |
n-Nitrosodiethylamine can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C4H10N2O |
---|---|
Canonical SMILES | CCN(CC)N=O |
Isomeric SMILES | CCN(CC)N=O |
Molecular Weight | 102.1400 |
InChIKey | WBNQDOYYEUMPFS-UHFFFAOYSA-N |
InChI | InChI=1S/C4H10N2O/c1-3-6(4-2)5-7/h3-4H2,1-2H3 |
XLogP | 0.5000 |
ExactMass | 102.0793 |
MonoisotopicMass | 102.0793 |
TPSA | 32.7000 |
Complexity | 51.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 3 |
RotatableBondCount | 2 |
HeavyAtomCount | 7 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 2615 |
PatentFamilyCount | 1042 |
LiteratureCount | 7300 |