1 | N-NITROSODIMETHYLAMINE |
2 | Dimethylnitrosamine |
3 | Dimethylnitrosoamine |
4 | N-Methyl-N-nitrosomethanamine |
5 | Nitrosodimethylamine |
n-Nitrosodimethylamine can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C2H6N2O |
---|---|
Canonical SMILES | CN(C)N=O |
Isomeric SMILES | CN(C)N=O |
Molecular Weight | 74.0800 |
InChIKey | UMFJAHHVKNCGLG-UHFFFAOYSA-N |
InChI | InChI=1S/C2H6N2O/c1-4(2)3-5/h1-2H3 |
XLogP | -0.6000 |
ExactMass | 74.0480 |
MonoisotopicMass | 74.0480 |
TPSA | 32.7000 |
Complexity | 34.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 3 |
RotatableBondCount | 0 |
HeavyAtomCount | 5 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 7004 |
PatentFamilyCount | 2637 |
LiteratureCount | 6685 |