| 1 | N-NITROSODIMETHYLAMINE |
| 2 | Dimethylnitrosamine |
| 3 | Dimethylnitrosoamine |
| 4 | N-Methyl-N-nitrosomethanamine |
| 5 | Nitrosodimethylamine |
n-Nitrosodimethylamine can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C2H6N2O |
|---|---|
| Canonical SMILES | CN(C)N=O |
| Isomeric SMILES | CN(C)N=O |
| Molecular Weight | 74.0800 |
| InChIKey | UMFJAHHVKNCGLG-UHFFFAOYSA-N |
| InChI | InChI=1S/C2H6N2O/c1-4(2)3-5/h1-2H3 |
| XLogP | -0.6000 |
| ExactMass | 74.0480 |
| MonoisotopicMass | 74.0480 |
| TPSA | 32.7000 |
| Complexity | 34.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 5 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 7004 |
| PatentFamilyCount | 2637 |
| LiteratureCount | 6685 |