1 | N-NITROSODIPHENYLAMINE |
2 | Diphenylnitrosamine |
3 | Nitrosodiphenylamine |
4 | Benzenamine, N-nitroso-N-phenyl- |
5 | Vultrol |
N-Nitrosodiphenylamine can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C12H10N2O |
---|---|
Canonical SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)N=O |
Isomeric SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)N=O |
Molecular Weight | 198.2200 |
InChIKey | UBUCNCOMADRQHX-UHFFFAOYSA-N |
InChI | InChI=1S/C12H10N2O/c15-13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
XLogP | 3.1000 |
ExactMass | 198.0793 |
MonoisotopicMass | 198.0793 |
TPSA | 32.7000 |
Complexity | 178.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 3 |
RotatableBondCount | 2 |
HeavyAtomCount | 15 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 8944 |
PatentFamilyCount | 3664 |
LiteratureCount | 413 |