1 | N-NITROSO-N-METHYLURETHANE |
2 | N-Methyl-N-nitrosourethane |
3 | Methylnitrosourethane |
4 | Nitrosomethylurethane |
5 | Ethyl N-Methyl-N-nitrosocarbamate |
N-Nitroso-N-methylurethane can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C4H8N2O3 |
---|---|
Canonical SMILES | CCOC(=O)N(C)N=O |
Isomeric SMILES | CCOC(=O)N(C)N=O |
Molecular Weight | 132.1200 |
InChIKey | CAUBWLYZCDDYEF-UHFFFAOYSA-N |
InChI | InChI=1S/C4H8N2O3/c1-3-9-4(7)6(2)5-8/h3H2,1-2H3 |
XLogP | 0.2000 |
ExactMass | 132.0535 |
MonoisotopicMass | 132.0535 |
TPSA | 59.0000 |
Complexity | 114.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 4 |
RotatableBondCount | 2 |
HeavyAtomCount | 9 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 679 |
PatentFamilyCount | 245 |
LiteratureCount | 431 |