| 1 | Methylvinylnitrosamine |
| 2 | N-NITROSOMETHYLVINYLAMINE |
| 3 | MVNA |
| 4 | NMVA |
| 5 | Methylvinylnitrosoamine |
N-Nitrosomethylvinylamine can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C3H6N2O |
|---|---|
| Canonical SMILES | CN(C=C)N=O |
| Isomeric SMILES | CN(C=C)N=O |
| Molecular Weight | 86.0900 |
| InChIKey | AWZVYNHQGTZJIH-UHFFFAOYSA-N |
| InChI | InChI=1S/C3H6N2O/c1-3-5(2)4-6/h3H,1H2,2H3 |
| XLogP | 0.7000 |
| ExactMass | 86.0480 |
| MonoisotopicMass | 86.0480 |
| TPSA | 32.7000 |
| Complexity | 61.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 6 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 140 |
| PatentFamilyCount | 102 |
| LiteratureCount | 48 |