1 | Methylvinylnitrosamine |
2 | N-NITROSOMETHYLVINYLAMINE |
3 | MVNA |
4 | NMVA |
5 | Methylvinylnitrosoamine |
N-Nitrosomethylvinylamine can cause cancer according to an independent committee of scientific and health experts.
Molecular Formula | C3H6N2O |
---|---|
Canonical SMILES | CN(C=C)N=O |
Isomeric SMILES | CN(C=C)N=O |
Molecular Weight | 86.0900 |
InChIKey | AWZVYNHQGTZJIH-UHFFFAOYSA-N |
InChI | InChI=1S/C3H6N2O/c1-3-5(2)4-6/h3H,1H2,2H3 |
XLogP | 0.7000 |
ExactMass | 86.0480 |
MonoisotopicMass | 86.0480 |
TPSA | 32.7000 |
Complexity | 61.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 3 |
RotatableBondCount | 1 |
HeavyAtomCount | 6 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 140 |
PatentFamilyCount | 102 |
LiteratureCount | 48 |