1 | Thiosemicarbazide |
2 | Hydrazinecarbothioamide |
3 | aminothiourea |
4 | N-Aminothiourea |
5 | 1-Aminothiourea |
Hydrazinecarbothioamide is a member of the class of thioureas that is thiourea in which a hydrogen of one of the amino groups is replaced by an amino group. It is a member of hydrazines, a thiocarboxamide and a member of thioureas.
Molecular Formula | CH5N3S |
---|---|
Canonical SMILES | C(=S)(N)NN |
Isomeric SMILES | C(=S)(N)NN |
Molecular Weight | 91.1400 |
InChIKey | BRWIZMBXBAOCCF-UHFFFAOYSA-N |
InChI | InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) |
XLogP | -1.2000 |
ExactMass | 91.0204 |
MonoisotopicMass | 91.0204 |
TPSA | 96.2000 |
Complexity | 42.0000 |
Charge | 0.0000 |
HBondDonorCount | 3 |
HBondAcceptorCount | 2 |
RotatableBondCount | 0 |
HeavyAtomCount | 5 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 19342 |
PatentFamilyCount | 7844 |
LiteratureCount | 5710 |