Tris(2,3-dibromopropyl) phosphate
CAS: 126-72-7
| 1 | Tris(2,3-dibromopropyl) phosphate |
| 2 | Tris(2,3-dibromopropyl)phosphate |
| 3 | TDBPP |
| 4 | Tris-BP |
| 5 | Anfram 3PB |
Tris(2,3-dibromopropyl)phosphate can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C9H15Br6O4P |
|---|---|
| Canonical SMILES | C(C(CBr)Br)OP(=O)(OCC(CBr)Br)OCC(CBr)Br |
| Isomeric SMILES | C(C(CBr)Br)OP(=O)(OCC(CBr)Br)OCC(CBr)Br |
| Molecular Weight | 697.6000 |
| InChIKey | PQYJRMFWJJONBO-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H15Br6O4P/c10-1-7(13)4-17-20(16,18-5-8(14)2-11)19-6-9(15)3-12/h7-9H,1-6H2 |
| XLogP | 4.3000 |
| ExactMass | 697.5747 |
| MonoisotopicMass | 691.5808 |
| TPSA | 44.8000 |
| Complexity | 255.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 12 |
| HeavyAtomCount | 20 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 3 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 3 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 11314 |
| PatentFamilyCount | 4077 |
| LiteratureCount | 424 |