| 1 | Benzo[k]fluoranthene |
| 2 | BENZO(K)FLUORANTHENE |
| 3 | 8,9-Benzofluoranthene |
| 4 | 11,12-Benzofluoranthene |
| 5 | Dibenzo(b,jk)fluorene |
Benzo[k]fluoranthene can cause cancer according to an independent committee of scientific and health experts.
| Molecular Formula | C20H12 |
|---|---|
| Canonical SMILES | C1=CC=C2C=C3C4=CC=CC5=C4C(=CC=C5)C3=CC2=C1 |
| Isomeric SMILES | C1=CC=C2C=C3C4=CC=CC5=C4C(=CC=C5)C3=CC2=C1 |
| Molecular Weight | 252.3000 |
| InChIKey | HAXBIWFMXWRORI-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H |
| XLogP | 6.4000 |
| ExactMass | 252.0939 |
| MonoisotopicMass | 252.0939 |
| TPSA | 0.0000 |
| Complexity | 338.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 0 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 20 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 1993 |
| PatentFamilyCount | 876 |
| LiteratureCount | 3304 |